C20H14ClF6NOS — CID 151812547
3-(4-chlorophenyl)-5-(trifluoromethyl)-4-[(2,3,6-trifluoro-4-propylphenoxy)methyl]-1,2-thiazole (PubChem CID 151812547) has the molecular formula C20H14ClF6NOS and a molecular weight of 465.85 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-(trifluoromethyl)-4-[(2,3,6-trifluoro-4-propylphenoxy)methyl]-1,2-thiazole.
| Compound Name | 3-(4-chlorophenyl)-5-(trifluoromethyl)-4-[(2,3,6-trifluoro-4-propylphenoxy)methyl]-1,2-thiazole |
|---|---|
| PubChem CID | 151812547 |
| Molecular Formula | C20H14ClF6NOS |
| Molecular Weight | 465.85 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | 3-(4-chlorophenyl)-5-(trifluoromethyl)-4-[(2,3,6-trifluoro-4-propylphenoxy)methyl]-1,2-thiazole |
| SMILES | CCCc1cc(F)c(OCc2c(-c3ccc(Cl)cc3)nsc2C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C20H14ClF6NOS/c1-2-3-11-8-14(22)18(16(24)15(11)23)29-9-13-17(10-4-6-12(21)7-5-10)28-30-19(13)20(25,26)27/h4-8H,2-3,9H2,1H3 |
| InChIKey | SAXOOMLVDKDDQA-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.85 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|