About 5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine
5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine (PubChem CID 151812979) has the molecular formula C7H15N5O2
and a molecular weight of 201.23 g/mol. Its IUPAC name is 5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine.
Molecular Properties
| Compound Name | 5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine |
| PubChem CID | 151812979 |
| Molecular Formula | C7H15N5O2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine |
| SMILES | [H]/N=C1\C(CC)CN(C)N([N+](=O)[O-])N1C |
| InChI | InChI=1S/C7H15N5O2/c1-4-6-5-9(2)11(12(13)14)10(3)7(6)8/h6,8H,4-5H2,1-3H3/b8-7+ |
| InChIKey | SAZVFDOKVDJFAR-BQYQJAHWSA-N |
| XLogP | 0.19 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine?
The IUPAC name of 5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine (CID 151812979) is 5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine.
What is the SMILES notation for 5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine?
The canonical SMILES for 5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine is [H]/N=C1\C(CC)CN(C)N([N+](=O)[O-])N1C.
What is the InChIKey of 5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine?
The InChIKey is SAZVFDOKVDJFAR-BQYQJAHWSA-N. The full InChI is InChI=1S/C7H15N5O2/c1-4-6-5-9(2)11(12(13)14)10(3)7(6)8/h6,8H,4-5H2,1-3H3/b8-7+.
What are the key properties of 5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine?
5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine has a molecular weight of 201.23 g/mol, XLogP of 0.19, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,3-dimethyl-2-nitrotriazinan-4-imine is sourced from PubChem (CID 151812979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).