C14H19IN2O4 — CID 151813326
tert-butyl N-[1-(2-iodo-4-nitrophenyl)propan-2-yl]carbamate (PubChem CID 151813326) has the molecular formula C14H19IN2O4 and a molecular weight of 406.22 g/mol. Its IUPAC name is tert-butyl N-[1-(2-iodo-4-nitrophenyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-iodo-4-nitrophenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 151813326 |
| Molecular Formula | C14H19IN2O4 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | tert-butyl N-[1-(2-iodo-4-nitrophenyl)propan-2-yl]carbamate |
| SMILES | CC(Cc1ccc([N+](=O)[O-])cc1I)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H19IN2O4/c1-9(16-13(18)21-14(2,3)4)7-10-5-6-11(17(19)20)8-12(10)15/h5-6,8-9H,7H2,1-4H3,(H,16,18) |
| InChIKey | SBBNQYLRIATPFS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|