C31H44F3O3P — CID 15181508
1,3,7,9-tetratert-butyl-11-(2,2,2-trifluoroethoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine (PubChem CID 15181508) has the molecular formula C31H44F3O3P and a molecular weight of 552.66 g/mol. Its IUPAC name is 1,3,7,9-tetratert-butyl-11-(2,2,2-trifluoroethoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine.
| Compound Name | 1,3,7,9-tetratert-butyl-11-(2,2,2-trifluoroethoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine |
|---|---|
| PubChem CID | 15181508 |
| Molecular Formula | C31H44F3O3P |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | 1,3,7,9-tetratert-butyl-11-(2,2,2-trifluoroethoxy)-5H-benzo[d][1,3,2]benzodioxaphosphocine |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OP(OCC(F)(F)F)Oc1c(cc(C(C)(C)C)cc1C(C)(C)C)C2 |
| InChI | InChI=1S/C31H44F3O3P/c1-27(2,3)21-14-19-13-20-15-22(28(4,5)6)17-24(30(10,11)12)26(20)37-38(35-18-31(32,33)34)36-25(19)23(16-21)29(7,8)9/h14-17H,13,18H2,1-12H3 |
| InChIKey | KTTCGZAVTNCWDD-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|