C9H11F3N2O — CID 151815999
N,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyridin-2-amine (PubChem CID 151815999) has the molecular formula C9H11F3N2O and a molecular weight of 220.19 g/mol. Its IUPAC name is N,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyridin-2-amine.
| Compound Name | N,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 151815999 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N,4-dimethyl-5-(2,2,2-trifluoroethoxy)pyridin-2-amine |
| SMILES | CNc1cc(C)c(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H11F3N2O/c1-6-3-8(13-2)14-4-7(6)15-5-9(10,11)12/h3-4H,5H2,1-2H3,(H,13,14) |
| InChIKey | SBPKKXOOINRXPG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |