C21H21FN6O — CID 151817565
2-[2-[[2-(2-fluoro-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]phenol (PubChem CID 151817565) has the molecular formula C21H21FN6O and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-[2-[[2-(2-fluoro-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]phenol.
| Compound Name | 2-[2-[[2-(2-fluoro-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 151817565 |
| Molecular Formula | C21H21FN6O |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[2-[[2-(2-fluoro-3-pyridinyl)-9-propan-2-ylpurin-6-yl]amino]ethyl]phenol |
| SMILES | CC(C)n1cnc2c(NCCc3ccccc3O)nc(-c3cccnc3F)nc21 |
| InChI | InChI=1S/C21H21FN6O/c1-13(2)28-12-25-17-20(24-11-9-14-6-3-4-8-16(14)29)26-19(27-21(17)28)15-7-5-10-23-18(15)22/h3-8,10,12-13,29H,9,11H2,1-2H3,(H,24,26,27) |
| InChIKey | SBXWPHRTCKFOCB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|