C21H46O3Si2 — CID 15182176
(E,2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-tri(propan-2-yl)silyloxyhex-4-en-2-ol (PubChem CID 15182176) has the molecular formula C21H46O3Si2 and a molecular weight of 402.77 g/mol. Its IUPAC name is (E,2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-tri(propan-2-yl)silyloxyhex-4-en-2-ol.
| Compound Name | (E,2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-tri(propan-2-yl)silyloxyhex-4-en-2-ol |
|---|---|
| PubChem CID | 15182176 |
| Molecular Formula | C21H46O3Si2 |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | (E,2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-tri(propan-2-yl)silyloxyhex-4-en-2-ol |
| SMILES | C/C=C/[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H46O3Si2/c1-13-14-20(19(22)15-23-25(11,12)21(8,9)10)24-26(16(2)3,17(4)5)18(6)7/h13-14,16-20,22H,15H2,1-12H3/b14-13+/t19-,20-/m0/s1 |
| InChIKey | PDSLYLKIBWSEHH-JAPHFTBRSA-N |
| XLogP | 6.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|