About 6-azido-5-chloro-1,3-benzoxazole
6-azido-5-chloro-1,3-benzoxazole (PubChem CID 151821768) has the molecular formula C7H3ClN4O
and a molecular weight of 194.58 g/mol. Its IUPAC name is 6-azido-5-chloro-1,3-benzoxazole.
Molecular Properties
| Compound Name | 6-azido-5-chloro-1,3-benzoxazole |
| PubChem CID | 151821768 |
| Molecular Formula | C7H3ClN4O |
| Molecular Weight | 194.58 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 6-azido-5-chloro-1,3-benzoxazole |
| SMILES | [N-]=[N+]=Nc1cc2ocnc2cc1Cl |
| InChI | InChI=1S/C7H3ClN4O/c8-4-1-6-7(13-3-10-6)2-5(4)11-12-9/h1-3H |
| InChIKey | SCUBYDAWIWBTCC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-azido-5-chloro-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azido-5-chloro-1,3-benzoxazole?
The IUPAC name of 6-azido-5-chloro-1,3-benzoxazole (CID 151821768) is 6-azido-5-chloro-1,3-benzoxazole.
What is the SMILES notation for 6-azido-5-chloro-1,3-benzoxazole?
The canonical SMILES for 6-azido-5-chloro-1,3-benzoxazole is [N-]=[N+]=Nc1cc2ocnc2cc1Cl.
What is the InChIKey of 6-azido-5-chloro-1,3-benzoxazole?
The InChIKey is SCUBYDAWIWBTCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClN4O/c8-4-1-6-7(13-3-10-6)2-5(4)11-12-9/h1-3H.
What are the key properties of 6-azido-5-chloro-1,3-benzoxazole?
6-azido-5-chloro-1,3-benzoxazole has a molecular weight of 194.58 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azido-5-chloro-1,3-benzoxazole is sourced from PubChem (CID 151821768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).