C15H20BClN2O2 — CID 151821859
4-chloro-2-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 151821859) has the molecular formula C15H20BClN2O2 and a molecular weight of 306.60 g/mol. Its IUPAC name is 4-chloro-2-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 4-chloro-2-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 151821859 |
| Molecular Formula | C15H20BClN2O2 |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 4-chloro-2-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | CCn1cc2c(Cl)c(B3OC(C)(C)C(C)(C)O3)ccc2n1 |
| InChI | InChI=1S/C15H20BClN2O2/c1-6-19-9-10-12(18-19)8-7-11(13(10)17)16-20-14(2,3)15(4,5)21-16/h7-9H,6H2,1-5H3 |
| InChIKey | SCUMEVINAJYGLH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.60 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|