About 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol
2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol (PubChem CID 151822085) has the molecular formula C8H8O2
and a molecular weight of 136.15 g/mol. Its IUPAC name is 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol |
| PubChem CID | 151822085 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol |
| SMILES | OCCc1cc2ccc1o2 |
| InChI | InChI=1S/C8H8O2/c9-4-3-6-5-7-1-2-8(6)10-7/h1-2,5,9H,3-4H2 |
| InChIKey | SCVQBXNVSBCMDC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol?
The IUPAC name of 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol (CID 151822085) is 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol.
What is the SMILES notation for 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol?
The canonical SMILES for 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol is OCCc1cc2ccc1o2.
What is the InChIKey of 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol?
The InChIKey is SCVQBXNVSBCMDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2/c9-4-3-6-5-7-1-2-8(6)10-7/h1-2,5,9H,3-4H2.
What are the key properties of 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol?
2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol has a molecular weight of 136.15 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethanol is sourced from PubChem (CID 151822085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).