C4H10N2 — CID 15182447
1-methylcyclopropane-1,2-diamine (PubChem CID 15182447) has the molecular formula C4H10N2 and a molecular weight of 86.14 g/mol. Its IUPAC name is 1-methylcyclopropane-1,2-diamine.
| Compound Name | 1-methylcyclopropane-1,2-diamine |
|---|---|
| PubChem CID | 15182447 |
| Molecular Formula | C4H10N2 |
| Molecular Weight | 86.14 g/mol |
| Exact Mass | 86.08 |
| IUPAC Name | 1-methylcyclopropane-1,2-diamine |
| SMILES | CC1(N)CC1N |
| InChI | InChI=1S/C4H10N2/c1-4(6)2-3(4)5/h3H,2,5-6H2,1H3 |
| InChIKey | OFGPADUXZCUDRS-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 86.14 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |