C20H29F5O4 — CID 151827158
1-(2,3,4,5,6-pentafluorophenoxy)tridecan-4-yloxymethanediol (PubChem CID 151827158) has the molecular formula C20H29F5O4 and a molecular weight of 428.44 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenoxy)tridecan-4-yloxymethanediol.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenoxy)tridecan-4-yloxymethanediol |
|---|---|
| PubChem CID | 151827158 |
| Molecular Formula | C20H29F5O4 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenoxy)tridecan-4-yloxymethanediol |
| SMILES | CCCCCCCCCC(CCCOc1c(F)c(F)c(F)c(F)c1F)OC(O)O |
| InChI | InChI=1S/C20H29F5O4/c1-2-3-4-5-6-7-8-10-13(29-20(26)27)11-9-12-28-19-17(24)15(22)14(21)16(23)18(19)25/h13,20,26-27H,2-12H2,1H3 |
| InChIKey | SDWGYMITUHBKBG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|