About 4-methyl-1,2,3,5-tetrahydrothieno[3,2-e][1,4]diazepine
4-methyl-1,2,3,5-tetrahydrothieno[3,2-e][1,4]diazepine (PubChem CID 151827450) has the molecular formula C8H12N2S
and a molecular weight of 168.27 g/mol. Its IUPAC name is 4-methyl-1,2,3,5-tetrahydrothieno[3,2-e][1,4]diazepine.
Analyze 4-methyl-1,2,3,5-tetrahydrothieno[3,2-e][1,4]diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,2,3,5-tetrahydrothieno[3,2-e][1,4]diazepine?
The IUPAC name of 4-methyl-1,2,3,5-tetrahydrothieno[3,2-e][1,4]diazepine (CID 151827450) is 4-methyl-1,2,3,5-tetrahydrothieno[3,2-e][1,4]diazepine.
What is the SMILES notation for 4-methyl-1,2,3,5-tetrahydrothieno[3,2-e][1,4]diazepine?
The canonical SMILES for 4-methyl-1,2,3,5-tetrahydrothieno[3,2-e][1,4]diazepine is CN1CCNc2ccsc2C1.
What is the InChIKey of 4-methyl-1,2,3,5-tetrahydrothieno[3,2-e][1,4]diazepine?
The InChIKey is SDXVLCQDXQZDPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S/c1-10-4-3-9-7-2-5-11-8(7)6-10/h2,5,9H,3-4,6H2,1H3.
What are the key properties of 4-methyl-1,2,3,5-tetrahydrothieno[3,2-e][1,4]diazepine?
4-methyl-1,2,3,5-tetrahydrothieno[3,2-e][1,4]diazepine has a molecular weight of 168.27 g/mol, XLogP of 1.61, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,2,3,5-tetrahydrothieno[3,2-e][1,4]diazepine is sourced from PubChem (CID 151827450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).