About methyl sulfate;1,2,4-trimethylpyridin-1-ium
methyl sulfate;1,2,4-trimethylpyridin-1-ium (PubChem CID 15182907) has the molecular formula C9H15NO4S
and a molecular weight of 233.29 g/mol. Its IUPAC name is methyl sulfate;1,2,4-trimethylpyridin-1-ium.
Molecular Properties
| Compound Name | methyl sulfate;1,2,4-trimethylpyridin-1-ium |
| PubChem CID | 15182907 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | methyl sulfate;1,2,4-trimethylpyridin-1-ium |
| SMILES | COS(=O)(=O)[O-].Cc1cc[n+](C)c(C)c1 |
| InChI | InChI=1S/C8H12N.CH4O4S/c1-7-4-5-9(3)8(2)6-7;1-5-6(2,3)4/h4-6H,1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | VYYFSQYIPZBSMO-UHFFFAOYSA-M |
| XLogP | 0.22 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze methyl sulfate;1,2,4-trimethylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl sulfate;1,2,4-trimethylpyridin-1-ium?
The IUPAC name of methyl sulfate;1,2,4-trimethylpyridin-1-ium (CID 15182907) is methyl sulfate;1,2,4-trimethylpyridin-1-ium.
What is the SMILES notation for methyl sulfate;1,2,4-trimethylpyridin-1-ium?
The canonical SMILES for methyl sulfate;1,2,4-trimethylpyridin-1-ium is COS(=O)(=O)[O-].Cc1cc[n+](C)c(C)c1.
What is the InChIKey of methyl sulfate;1,2,4-trimethylpyridin-1-ium?
The InChIKey is VYYFSQYIPZBSMO-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H12N.CH4O4S/c1-7-4-5-9(3)8(2)6-7;1-5-6(2,3)4/h4-6H,1-3H3;1H3,(H,2,3,4)/q+1;/p-1.
What are the key properties of methyl sulfate;1,2,4-trimethylpyridin-1-ium?
methyl sulfate;1,2,4-trimethylpyridin-1-ium has a molecular weight of 233.29 g/mol, XLogP of 0.22, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl sulfate;1,2,4-trimethylpyridin-1-ium is sourced from PubChem (CID 15182907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).