About 2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid
2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 151830701) has the molecular formula C9H12FNO2
and a molecular weight of 185.20 g/mol. Its IUPAC name is 2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 151830701 |
| Molecular Formula | C9H12FNO2 |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CC1C(F)=CC=C(N)C1(C)C(=O)O |
| InChI | InChI=1S/C9H12FNO2/c1-5-6(10)3-4-7(11)9(5,2)8(12)13/h3-5H,11H2,1-2H3,(H,12,13) |
| InChIKey | SEPAUNLLYSTXDA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid (CID 151830701) is 2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid is CC1C(F)=CC=C(N)C1(C)C(=O)O.
What is the InChIKey of 2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is SEPAUNLLYSTXDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FNO2/c1-5-6(10)3-4-7(11)9(5,2)8(12)13/h3-5H,11H2,1-2H3,(H,12,13).
What are the key properties of 2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid?
2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 185.20 g/mol, XLogP of 1.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-fluoro-1,6-dimethylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 151830701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).