About 1-chloro-4-fluoroindole
1-chloro-4-fluoroindole (PubChem CID 151831480) has the molecular formula C8H5ClFN
and a molecular weight of 169.59 g/mol. Its IUPAC name is 1-chloro-4-fluoroindole.
Molecular Properties
| Compound Name | 1-chloro-4-fluoroindole |
| PubChem CID | 151831480 |
| Molecular Formula | C8H5ClFN |
| Molecular Weight | 169.59 g/mol |
| Exact Mass | 169.01 |
| IUPAC Name | 1-chloro-4-fluoroindole |
| SMILES | Fc1cccc2c1ccn2Cl |
| InChI | InChI=1S/C8H5ClFN/c9-11-5-4-6-7(10)2-1-3-8(6)11/h1-5H |
| InChIKey | SETGSGOCAJHQIU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.59 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-4-fluoroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-fluoroindole?
The IUPAC name of 1-chloro-4-fluoroindole (CID 151831480) is 1-chloro-4-fluoroindole.
What is the SMILES notation for 1-chloro-4-fluoroindole?
The canonical SMILES for 1-chloro-4-fluoroindole is Fc1cccc2c1ccn2Cl.
What is the InChIKey of 1-chloro-4-fluoroindole?
The InChIKey is SETGSGOCAJHQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClFN/c9-11-5-4-6-7(10)2-1-3-8(6)11/h1-5H.
What are the key properties of 1-chloro-4-fluoroindole?
1-chloro-4-fluoroindole has a molecular weight of 169.59 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-fluoroindole is sourced from PubChem (CID 151831480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).