About 1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate
1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate (PubChem CID 15183291) has the molecular formula C10H10ClNO2
and a molecular weight of 211.65 g/mol. Its IUPAC name is 1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | 1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate |
| PubChem CID | 15183291 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate |
| SMILES | C#CC1C=CC=CN1C(=O)OC(C)Cl |
| InChI | InChI=1S/C10H10ClNO2/c1-3-9-6-4-5-7-12(9)10(13)14-8(2)11/h1,4-9H,2H3 |
| InChIKey | QJCNQQWRGAZXRB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate?
The IUPAC name of 1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate (CID 15183291) is 1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate.
What is the SMILES notation for 1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate?
The canonical SMILES for 1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate is C#CC1C=CC=CN1C(=O)OC(C)Cl.
What is the InChIKey of 1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate?
The InChIKey is QJCNQQWRGAZXRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNO2/c1-3-9-6-4-5-7-12(9)10(13)14-8(2)11/h1,4-9H,2H3.
What are the key properties of 1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate?
1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate has a molecular weight of 211.65 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethyl 2-ethynyl-2H-pyridine-1-carboxylate is sourced from PubChem (CID 15183291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).