C10H11Cl4NO2S — CID 15183332
[(1E)-1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl]sulfanylcyclohexane (PubChem CID 15183332) has the molecular formula C10H11Cl4NO2S and a molecular weight of 351.08 g/mol. Its IUPAC name is [(1E)-1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl]sulfanylcyclohexane.
| Compound Name | [(1E)-1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl]sulfanylcyclohexane |
|---|---|
| PubChem CID | 15183332 |
| Molecular Formula | C10H11Cl4NO2S |
| Molecular Weight | 351.08 g/mol |
| Exact Mass | 348.93 |
| IUPAC Name | [(1E)-1,3,4,4-tetrachloro-2-nitrobuta-1,3-dienyl]sulfanylcyclohexane |
| SMILES | O=[N+]([O-])/C(C(Cl)=C(Cl)Cl)=C(/Cl)SC1CCCCC1 |
| InChI | InChI=1S/C10H11Cl4NO2S/c11-7(9(12)13)8(15(16)17)10(14)18-6-4-2-1-3-5-6/h6H,1-5H2/b10-8- |
| InChIKey | XABJVBAKOSRTPG-NTMALXAHSA-N |
| XLogP | 5.62 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.08 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|