C16H18O4 — CID 151833407
3-benzyl-4,4-dihydroxy-3,5-dimethylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 151833407) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-benzyl-4,4-dihydroxy-3,5-dimethylcyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 3-benzyl-4,4-dihydroxy-3,5-dimethylcyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 151833407 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-benzyl-4,4-dihydroxy-3,5-dimethylcyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CC1=CC(C(=O)O)=CC(C)(Cc2ccccc2)C1(O)O |
| InChI | InChI=1S/C16H18O4/c1-11-8-13(14(17)18)10-15(2,16(11,19)20)9-12-6-4-3-5-7-12/h3-8,10,19-20H,9H2,1-2H3,(H,17,18) |
| InChIKey | SFDMOZUZKYOOAI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|