C14H20N2O6 — CID 151836177
2-(2-butoxycarbonylhydrazinyl)-2-(4-methylperoxyphenyl)acetic acid (PubChem CID 151836177) has the molecular formula C14H20N2O6 and a molecular weight of 312.32 g/mol. Its IUPAC name is 2-(2-butoxycarbonylhydrazinyl)-2-(4-methylperoxyphenyl)acetic acid.
| Compound Name | 2-(2-butoxycarbonylhydrazinyl)-2-(4-methylperoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 151836177 |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-(2-butoxycarbonylhydrazinyl)-2-(4-methylperoxyphenyl)acetic acid |
| SMILES | CCCCOC(=O)NNC(C(=O)O)c1ccc(OOC)cc1 |
| InChI | InChI=1S/C14H20N2O6/c1-3-4-9-21-14(19)16-15-12(13(17)18)10-5-7-11(8-6-10)22-20-2/h5-8,12,15H,3-4,9H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | SFRULNMGQWSICM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|