C4H5N2O4PS — CID 151836726
2-dihydroxyphosphinothioyloxy-1H-pyrimidin-6-one (PubChem CID 151836726) has the molecular formula C4H5N2O4PS and a molecular weight of 208.13 g/mol. Its IUPAC name is 2-dihydroxyphosphinothioyloxy-1H-pyrimidin-6-one.
| Compound Name | 2-dihydroxyphosphinothioyloxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 151836726 |
| Molecular Formula | C4H5N2O4PS |
| Molecular Weight | 208.13 g/mol |
| Exact Mass | 207.97 |
| IUPAC Name | 2-dihydroxyphosphinothioyloxy-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(OP(O)(O)=S)[nH]1 |
| InChI | InChI=1S/C4H5N2O4PS/c7-3-1-2-5-4(6-3)10-11(8,9)12/h1-2H,(H,5,6,7)(H2,8,9,12) |
| InChIKey | SFUWMJUGOGNYSU-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.13 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|