About 2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole
2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole (PubChem CID 151837889) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is 2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole.
Molecular Properties
| Compound Name | 2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole |
| PubChem CID | 151837889 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole |
| SMILES | CC=CC=Cc1[nH]c(C)c(C)c1C |
| InChI | InChI=1S/C12H17N/c1-5-6-7-8-12-10(3)9(2)11(4)13-12/h5-8,13H,1-4H3 |
| InChIKey | SGAUBVHZFWJAQL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole?
The IUPAC name of 2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole (CID 151837889) is 2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole.
What is the SMILES notation for 2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole?
The canonical SMILES for 2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole is CC=CC=Cc1[nH]c(C)c(C)c1C.
What is the InChIKey of 2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole?
The InChIKey is SGAUBVHZFWJAQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-5-6-7-8-12-10(3)9(2)11(4)13-12/h5-8,13H,1-4H3.
What are the key properties of 2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole?
2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole has a molecular weight of 175.28 g/mol, XLogP of 3.53, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-trimethyl-5-penta-1,3-dienyl-1H-pyrrole is sourced from PubChem (CID 151837889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).