About N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide
N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide (PubChem CID 151840140) has the molecular formula C26H29N5O4
and a molecular weight of 475.55 g/mol. Its IUPAC name is N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide.
Molecular Properties
| Compound Name | N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide |
| PubChem CID | 151840140 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide |
| SMILES | CCNC(=O)c1c(OC)cc(-n2cnc3cc(-c4cnn(C5CCOCC5)c4)ccc32)cc1OC |
| InChI | InChI=1S/C26H29N5O4/c1-4-27-26(32)25-23(33-2)12-20(13-24(25)34-3)30-16-28-21-11-17(5-6-22(21)30)18-14-29-31(15-18)19-7-9-35-10-8-19/h5-6,11-16,19H,4,7-10H2,1-3H3,(H,27,32) |
| InChIKey | SGMHSWUFNYQVBA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide?
The IUPAC name of N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide (CID 151840140) is N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide.
What is the SMILES notation for N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide?
The canonical SMILES for N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide is CCNC(=O)c1c(OC)cc(-n2cnc3cc(-c4cnn(C5CCOCC5)c4)ccc32)cc1OC.
What is the InChIKey of N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide?
The InChIKey is SGMHSWUFNYQVBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29N5O4/c1-4-27-26(32)25-23(33-2)12-20(13-24(25)34-3)30-16-28-21-11-17(5-6-22(21)30)18-14-29-31(15-18)19-7-9-35-10-8-19/h5-6,11-16,19H,4,7-10H2,1-3H3,(H,27,32).
What are the key properties of N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide?
N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide has a molecular weight of 475.55 g/mol, XLogP of 4.01, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,6-dimethoxy-4-[5-[1-(oxan-4-yl)pyrazol-4-yl]benzimidazol-1-yl]benzamide is sourced from PubChem (CID 151840140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).