About 5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine
5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine (PubChem CID 151840863) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 151840863 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine |
| SMILES | COc1ccc(C2(C)C=CC=C(N)C2)cc1OC |
| InChI | InChI=1S/C15H19NO2/c1-15(8-4-5-12(16)10-15)11-6-7-13(17-2)14(9-11)18-3/h4-9H,10,16H2,1-3H3 |
| InChIKey | SGPYVCDXNZUNOM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine?
The IUPAC name of 5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine (CID 151840863) is 5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for 5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine is COc1ccc(C2(C)C=CC=C(N)C2)cc1OC.
What is the InChIKey of 5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine?
The InChIKey is SGPYVCDXNZUNOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2/c1-15(8-4-5-12(16)10-15)11-6-7-13(17-2)14(9-11)18-3/h4-9H,10,16H2,1-3H3.
What are the key properties of 5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine?
5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine has a molecular weight of 245.32 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethoxyphenyl)-5-methylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 151840863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).