About (2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate
(2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate (PubChem CID 151842769) has the molecular formula C19H15F3N2O3S
and a molecular weight of 408.40 g/mol. Its IUPAC name is (2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | (2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate |
| PubChem CID | 151842769 |
| Molecular Formula | C19H15F3N2O3S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)(ONN(c1ccccc1)c1ccccc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H15F3N2O3S/c20-19(21,22)17-13-7-8-14-18(17)28(25,26)27-23-24(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,23H |
| InChIKey | SHACHKBOGDXUAE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate?
The IUPAC name of (2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate (CID 151842769) is (2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for (2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate?
The canonical SMILES for (2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate is O=S(=O)(ONN(c1ccccc1)c1ccccc1)c1ccccc1C(F)(F)F.
What is the InChIKey of (2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate?
The InChIKey is SHACHKBOGDXUAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F3N2O3S/c20-19(21,22)17-13-7-8-14-18(17)28(25,26)27-23-24(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,23H.
What are the key properties of (2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate?
(2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate has a molecular weight of 408.40 g/mol, XLogP of 4.67, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-diphenylhydrazinyl) 2-(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 151842769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).