About 17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one
17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one (PubChem CID 15184416) has the molecular formula C16H28O2S2
and a molecular weight of 316.53 g/mol. Its IUPAC name is 17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one.
Molecular Properties
| Compound Name | 17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one |
| PubChem CID | 15184416 |
| Molecular Formula | C16H28O2S2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one |
| SMILES | O=C1CCCCCCCCCCC2(CCO1)SCCS2 |
| InChI | InChI=1S/C16H28O2S2/c17-15-9-7-5-3-1-2-4-6-8-10-16(11-12-18-15)19-13-14-20-16/h1-14H2 |
| InChIKey | WOFDJYRZZOYUEK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one?
The IUPAC name of 17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one (CID 15184416) is 17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one.
What is the SMILES notation for 17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one?
The canonical SMILES for 17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one is O=C1CCCCCCCCCCC2(CCO1)SCCS2.
What is the InChIKey of 17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one?
The InChIKey is WOFDJYRZZOYUEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2S2/c17-15-9-7-5-3-1-2-4-6-8-10-16(11-12-18-15)19-13-14-20-16/h1-14H2.
What are the key properties of 17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one?
17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one has a molecular weight of 316.53 g/mol, XLogP of 5.01, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 17-oxa-1,4-dithiaspiro[4.14]nonadecan-16-one is sourced from PubChem (CID 15184416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).