About spiro[4.4]nonan-3-ol
spiro[4.4]nonan-3-ol (PubChem CID 15184481) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is spiro[4.4]nonan-3-ol.
Molecular Properties
| Compound Name | spiro[4.4]nonan-3-ol |
| PubChem CID | 15184481 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | spiro[4.4]nonan-3-ol |
| SMILES | OC1CCC2(CCCC2)C1 |
| InChI | InChI=1S/C9H16O/c10-8-3-6-9(7-8)4-1-2-5-9/h8,10H,1-7H2 |
| InChIKey | RWVAHZMFOQOBOU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[4.4]nonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4.4]nonan-3-ol?
The IUPAC name of spiro[4.4]nonan-3-ol (CID 15184481) is spiro[4.4]nonan-3-ol.
What is the SMILES notation for spiro[4.4]nonan-3-ol?
The canonical SMILES for spiro[4.4]nonan-3-ol is OC1CCC2(CCCC2)C1.
What is the InChIKey of spiro[4.4]nonan-3-ol?
The InChIKey is RWVAHZMFOQOBOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O/c10-8-3-6-9(7-8)4-1-2-5-9/h8,10H,1-7H2.
What are the key properties of spiro[4.4]nonan-3-ol?
spiro[4.4]nonan-3-ol has a molecular weight of 140.23 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4.4]nonan-3-ol is sourced from PubChem (CID 15184481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).