C12H14N6O10 — CID 151845032
1-(6-acetyl-4,4,8,8-tetranitro-2,6-diazatricyclo[3.3.1.13,7]decan-2-yl)ethanone (PubChem CID 151845032) has the molecular formula C12H14N6O10 and a molecular weight of 402.28 g/mol. Its IUPAC name is 1-(6-acetyl-4,4,8,8-tetranitro-2,6-diazatricyclo[3.3.1.13,7]decan-2-yl)ethanone.
| Compound Name | 1-(6-acetyl-4,4,8,8-tetranitro-2,6-diazatricyclo[3.3.1.13,7]decan-2-yl)ethanone |
|---|---|
| PubChem CID | 151845032 |
| Molecular Formula | C12H14N6O10 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 1-(6-acetyl-4,4,8,8-tetranitro-2,6-diazatricyclo[3.3.1.13,7]decan-2-yl)ethanone |
| SMILES | CC(=O)N1C2CC3N(C(C)=O)C(CC1C3([N+](=O)[O-])[N+](=O)[O-])C2([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N6O10/c1-5(19)13-7-3-9-12(17(25)26,18(27)28)8(13)4-10(14(9)6(2)20)11(7,15(21)22)16(23)24/h7-10H,3-4H2,1-2H3 |
| InChIKey | SHLYMYMIPLDGFQ-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 213.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|