C25H45NO2 — CID 151847312
8-ethyl-3,5-dioctyl-1,3,5,7-tetrahydropyrrolizine-2,6-dione (PubChem CID 151847312) has the molecular formula C25H45NO2 and a molecular weight of 391.64 g/mol. Its IUPAC name is 8-ethyl-3,5-dioctyl-1,3,5,7-tetrahydropyrrolizine-2,6-dione.
| Compound Name | 8-ethyl-3,5-dioctyl-1,3,5,7-tetrahydropyrrolizine-2,6-dione |
|---|---|
| PubChem CID | 151847312 |
| Molecular Formula | C25H45NO2 |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 391.35 |
| IUPAC Name | 8-ethyl-3,5-dioctyl-1,3,5,7-tetrahydropyrrolizine-2,6-dione |
| SMILES | CCCCCCCCC1C(=O)CC2(CC)CC(=O)C(CCCCCCCC)N12 |
| InChI | InChI=1S/C25H45NO2/c1-4-7-9-11-13-15-17-21-23(27)19-25(6-3)20-24(28)22(26(21)25)18-16-14-12-10-8-5-2/h21-22H,4-20H2,1-3H3 |
| InChIKey | SHXVLKNOFZHSAA-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|