About 4-(cyclohexen-1-yl)-1,3-dithiol-2-one
4-(cyclohexen-1-yl)-1,3-dithiol-2-one (PubChem CID 15184769) has the molecular formula C9H10OS2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 4-(cyclohexen-1-yl)-1,3-dithiol-2-one.
Molecular Properties
| Compound Name | 4-(cyclohexen-1-yl)-1,3-dithiol-2-one |
| PubChem CID | 15184769 |
| Molecular Formula | C9H10OS2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 4-(cyclohexen-1-yl)-1,3-dithiol-2-one |
| SMILES | O=c1scc(C2=CCCCC2)s1 |
| InChI | InChI=1S/C9H10OS2/c10-9-11-6-8(12-9)7-4-2-1-3-5-7/h4,6H,1-3,5H2 |
| InChIKey | ZXIVNSPUBBEIPH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(cyclohexen-1-yl)-1,3-dithiol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclohexen-1-yl)-1,3-dithiol-2-one?
The IUPAC name of 4-(cyclohexen-1-yl)-1,3-dithiol-2-one (CID 15184769) is 4-(cyclohexen-1-yl)-1,3-dithiol-2-one.
What is the SMILES notation for 4-(cyclohexen-1-yl)-1,3-dithiol-2-one?
The canonical SMILES for 4-(cyclohexen-1-yl)-1,3-dithiol-2-one is O=c1scc(C2=CCCCC2)s1.
What is the InChIKey of 4-(cyclohexen-1-yl)-1,3-dithiol-2-one?
The InChIKey is ZXIVNSPUBBEIPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10OS2/c10-9-11-6-8(12-9)7-4-2-1-3-5-7/h4,6H,1-3,5H2.
What are the key properties of 4-(cyclohexen-1-yl)-1,3-dithiol-2-one?
4-(cyclohexen-1-yl)-1,3-dithiol-2-one has a molecular weight of 198.31 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclohexen-1-yl)-1,3-dithiol-2-one is sourced from PubChem (CID 15184769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).