C17H22N4O2 — CID 151850122
5-cyclopentyl-11-(2-methylpropyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione (PubChem CID 151850122) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-cyclopentyl-11-(2-methylpropyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione.
| Compound Name | 5-cyclopentyl-11-(2-methylpropyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
|---|---|
| PubChem CID | 151850122 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 5-cyclopentyl-11-(2-methylpropyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
| SMILES | CC(C)Cc1cc2nc3c(c(=O)n2[nH]1)CN(C1CCCC1)C3=O |
| InChI | InChI=1S/C17H22N4O2/c1-10(2)7-11-8-14-18-15-13(16(22)21(14)19-11)9-20(17(15)23)12-5-3-4-6-12/h8,10,12,19H,3-7,9H2,1-2H3 |
| InChIKey | VFHYRIBHDCZKTR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |