About bis(2-methylpropyl) 2-sulfanylpropanedioate
bis(2-methylpropyl) 2-sulfanylpropanedioate (PubChem CID 151854419) has the molecular formula C11H20O4S
and a molecular weight of 248.34 g/mol. Its IUPAC name is bis(2-methylpropyl) 2-sulfanylpropanedioate.
Molecular Properties
| Compound Name | bis(2-methylpropyl) 2-sulfanylpropanedioate |
| PubChem CID | 151854419 |
| Molecular Formula | C11H20O4S |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | bis(2-methylpropyl) 2-sulfanylpropanedioate |
| SMILES | CC(C)COC(=O)C(S)C(=O)OCC(C)C |
| InChI | InChI=1S/C11H20O4S/c1-7(2)5-14-10(12)9(16)11(13)15-6-8(3)4/h7-9,16H,5-6H2,1-4H3 |
| InChIKey | SJJJSUJGMFHMAY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylpropyl) 2-sulfanylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpropyl) 2-sulfanylpropanedioate?
The IUPAC name of bis(2-methylpropyl) 2-sulfanylpropanedioate (CID 151854419) is bis(2-methylpropyl) 2-sulfanylpropanedioate.
What is the SMILES notation for bis(2-methylpropyl) 2-sulfanylpropanedioate?
The canonical SMILES for bis(2-methylpropyl) 2-sulfanylpropanedioate is CC(C)COC(=O)C(S)C(=O)OCC(C)C.
What is the InChIKey of bis(2-methylpropyl) 2-sulfanylpropanedioate?
The InChIKey is SJJJSUJGMFHMAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4S/c1-7(2)5-14-10(12)9(16)11(13)15-6-8(3)4/h7-9,16H,5-6H2,1-4H3.
What are the key properties of bis(2-methylpropyl) 2-sulfanylpropanedioate?
bis(2-methylpropyl) 2-sulfanylpropanedioate has a molecular weight of 248.34 g/mol, XLogP of 1.68, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropyl) 2-sulfanylpropanedioate is sourced from PubChem (CID 151854419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).