C20H14N2O4 — CID 15185493
2,7-bis(prop-2-enyl)isoindolo[5,6-f]isoindole-1,3,6,8-tetrone (PubChem CID 15185493) has the molecular formula C20H14N2O4 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2,7-bis(prop-2-enyl)isoindolo[5,6-f]isoindole-1,3,6,8-tetrone.
| Compound Name | 2,7-bis(prop-2-enyl)isoindolo[5,6-f]isoindole-1,3,6,8-tetrone |
|---|---|
| PubChem CID | 15185493 |
| Molecular Formula | C20H14N2O4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2,7-bis(prop-2-enyl)isoindolo[5,6-f]isoindole-1,3,6,8-tetrone |
| SMILES | C=CCn1c(=O)c2cc3cc4c(=O)n(CC=C)c(=O)c4cc3cc2c1=O |
| InChI | InChI=1S/C20H14N2O4/c1-3-5-21-17(23)13-7-11-9-15-16(10-12(11)8-14(13)18(21)24)20(26)22(6-4-2)19(15)25/h3-4,7-10H,1-2,5-6H2 |
| InChIKey | CZFLINQMFBVNRG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|