About 1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine
1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine (PubChem CID 15185521) has the molecular formula C8H13N5
and a molecular weight of 179.23 g/mol. Its IUPAC name is 1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine |
| PubChem CID | 15185521 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CN1CCC=C(c2nnnn2C)C1 |
| InChI | InChI=1S/C8H13N5/c1-12-5-3-4-7(6-12)8-9-10-11-13(8)2/h4H,3,5-6H2,1-2H3 |
| InChIKey | INOQPVRNJBTWPG-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine (CID 15185521) is 1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine is CN1CCC=C(c2nnnn2C)C1.
What is the InChIKey of 1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine?
The InChIKey is INOQPVRNJBTWPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5/c1-12-5-3-4-7(6-12)8-9-10-11-13(8)2/h4H,3,5-6H2,1-2H3.
What are the key properties of 1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine?
1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine has a molecular weight of 179.23 g/mol, XLogP of -0.07, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-(1-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 15185521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).