About (E)-1,1-difluoronon-2-ene
(E)-1,1-difluoronon-2-ene (PubChem CID 15185670) has the molecular formula C9H16F2
and a molecular weight of 162.22 g/mol. Its IUPAC name is (E)-1,1-difluoronon-2-ene.
Molecular Properties
| Compound Name | (E)-1,1-difluoronon-2-ene |
| PubChem CID | 15185670 |
| Molecular Formula | C9H16F2 |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (E)-1,1-difluoronon-2-ene |
| SMILES | CCCCCC/C=C/C(F)F |
| InChI | InChI=1S/C9H16F2/c1-2-3-4-5-6-7-8-9(10)11/h7-9H,2-6H2,1H3/b8-7+ |
| InChIKey | XACXTQMXEBRGMA-BQYQJAHWSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,1-difluoronon-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,1-difluoronon-2-ene?
The IUPAC name of (E)-1,1-difluoronon-2-ene (CID 15185670) is (E)-1,1-difluoronon-2-ene.
What is the SMILES notation for (E)-1,1-difluoronon-2-ene?
The canonical SMILES for (E)-1,1-difluoronon-2-ene is CCCCCC/C=C/C(F)F.
What is the InChIKey of (E)-1,1-difluoronon-2-ene?
The InChIKey is XACXTQMXEBRGMA-BQYQJAHWSA-N. The full InChI is InChI=1S/C9H16F2/c1-2-3-4-5-6-7-8-9(10)11/h7-9H,2-6H2,1H3/b8-7+.
What are the key properties of (E)-1,1-difluoronon-2-ene?
(E)-1,1-difluoronon-2-ene has a molecular weight of 162.22 g/mol, XLogP of 3.78, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,1-difluoronon-2-ene is sourced from PubChem (CID 15185670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).