C16H21NO5 — CID 151857946
3-O-benzyl 1-O-(2,2-dimethylpropanoyl) 2-amino-2-methylpropanedioate (PubChem CID 151857946) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-O-benzyl 1-O-(2,2-dimethylpropanoyl) 2-amino-2-methylpropanedioate.
| Compound Name | 3-O-benzyl 1-O-(2,2-dimethylpropanoyl) 2-amino-2-methylpropanedioate |
|---|---|
| PubChem CID | 151857946 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-O-benzyl 1-O-(2,2-dimethylpropanoyl) 2-amino-2-methylpropanedioate |
| SMILES | CC(C)(C)C(=O)OC(=O)C(C)(N)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO5/c1-15(2,3)12(18)22-14(20)16(4,17)13(19)21-10-11-8-6-5-7-9-11/h5-9H,10,17H2,1-4H3 |
| InChIKey | SKBXJLCTWLZHIS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|