About N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine
N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine (PubChem CID 151858532) has the molecular formula C16H15F3N6O2
and a molecular weight of 380.33 g/mol. Its IUPAC name is N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine.
Molecular Properties
| Compound Name | N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine |
| PubChem CID | 151858532 |
| Molecular Formula | C16H15F3N6O2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine |
| SMILES | COc1cc(-n2cnc3c(NC4CC4)nc(C(F)(F)F)nc32)cc(OC)n1 |
| InChI | InChI=1S/C16H15F3N6O2/c1-26-10-5-9(6-11(22-10)27-2)25-7-20-12-13(21-8-3-4-8)23-15(16(17,18)19)24-14(12)25/h5-8H,3-4H2,1-2H3,(H,21,23,24) |
| InChIKey | SKFCTYZIDIQAHC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine?
The IUPAC name of N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine (CID 151858532) is N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine.
What is the SMILES notation for N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine?
The canonical SMILES for N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine is COc1cc(-n2cnc3c(NC4CC4)nc(C(F)(F)F)nc32)cc(OC)n1.
What is the InChIKey of N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine?
The InChIKey is SKFCTYZIDIQAHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F3N6O2/c1-26-10-5-9(6-11(22-10)27-2)25-7-20-12-13(21-8-3-4-8)23-15(16(17,18)19)24-14(12)25/h5-8H,3-4H2,1-2H3,(H,21,23,24).
What are the key properties of N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine?
N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine has a molecular weight of 380.33 g/mol, XLogP of 2.82, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-9-(2,6-dimethoxy-4-pyridinyl)-2-(trifluoromethyl)purin-6-amine is sourced from PubChem (CID 151858532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).