C22H28NO3+ — CID 15186257
16,16-diethoxy-12-methoxy-15,15-dimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene (PubChem CID 15186257) has the molecular formula C22H28NO3+ and a molecular weight of 354.47 g/mol. Its IUPAC name is 16,16-diethoxy-12-methoxy-15,15-dimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene.
| Compound Name | 16,16-diethoxy-12-methoxy-15,15-dimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene |
|---|---|
| PubChem CID | 15186257 |
| Molecular Formula | C22H28NO3+ |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 16,16-diethoxy-12-methoxy-15,15-dimethyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene |
| SMILES | CCOC1(OCC)C2c3ccc(OC)cc3C([n+]3ccccc32)C1(C)C |
| InChI | InChI=1S/C22H28NO3/c1-6-25-22(26-7-2)19-16-12-11-15(24-5)14-17(16)20(21(22,3)4)23-13-9-8-10-18(19)23/h8-14,19-20H,6-7H2,1-5H3/q+1 |
| InChIKey | NVFLNAMHCOOEHX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|