About 8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione
8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione (PubChem CID 15186312) has the molecular formula C9H14O4S2
and a molecular weight of 250.34 g/mol. Its IUPAC name is 8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione.
Molecular Properties
| Compound Name | 8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione |
| PubChem CID | 15186312 |
| Molecular Formula | C9H14O4S2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione |
| SMILES | CC1CSCC(=O)OCCOC(=O)CS1 |
| InChI | InChI=1S/C9H14O4S2/c1-7-4-14-5-8(10)12-2-3-13-9(11)6-15-7/h7H,2-6H2,1H3 |
| InChIKey | ACQMLNLSTHISOC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione?
The IUPAC name of 8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione (CID 15186312) is 8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione.
What is the SMILES notation for 8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione?
The canonical SMILES for 8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione is CC1CSCC(=O)OCCOC(=O)CS1.
What is the InChIKey of 8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione?
The InChIKey is ACQMLNLSTHISOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4S2/c1-7-4-14-5-8(10)12-2-3-13-9(11)6-15-7/h7H,2-6H2,1H3.
What are the key properties of 8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione?
8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione has a molecular weight of 250.34 g/mol, XLogP of 0.94, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1,4-dioxa-7,10-dithiacyclododecane-5,12-dione is sourced from PubChem (CID 15186312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).