About 1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine
1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine (PubChem CID 151864546) has the molecular formula C14H19F2N3O
and a molecular weight of 283.32 g/mol. Its IUPAC name is 1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine.
Molecular Properties
| Compound Name | 1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine |
| PubChem CID | 151864546 |
| Molecular Formula | C14H19F2N3O |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine |
| SMILES | Fc1cc(O[C@@H]2CNC[C@H]2F)ccc1N1CCNCC1 |
| InChI | InChI=1S/C14H19F2N3O/c15-11-7-10(20-14-9-18-8-12(14)16)1-2-13(11)19-5-3-17-4-6-19/h1-2,7,12,14,17-18H,3-6,8-9H2/t12-,14-/m1/s1 |
| InChIKey | SLKATEMBAWPREV-TZMCWYRMSA-N |
| XLogP | 0.92 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine?
The IUPAC name of 1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine (CID 151864546) is 1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine.
What is the SMILES notation for 1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine?
The canonical SMILES for 1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine is Fc1cc(O[C@@H]2CNC[C@H]2F)ccc1N1CCNCC1.
What is the InChIKey of 1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine?
The InChIKey is SLKATEMBAWPREV-TZMCWYRMSA-N. The full InChI is InChI=1S/C14H19F2N3O/c15-11-7-10(20-14-9-18-8-12(14)16)1-2-13(11)19-5-3-17-4-6-19/h1-2,7,12,14,17-18H,3-6,8-9H2/t12-,14-/m1/s1.
What are the key properties of 1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine?
1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine has a molecular weight of 283.32 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-fluoro-4-[(3R,4R)-4-fluoropyrrolidin-3-yl]oxyphenyl]piperazine is sourced from PubChem (CID 151864546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).