C24H29ClN4O4 — CID 151865649
methyl N-[1-[2-[[3-(4-chlorophenyl)anilino]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 151865649) has the molecular formula C24H29ClN4O4 and a molecular weight of 472.97 g/mol. Its IUPAC name is methyl N-[1-[2-[[3-(4-chlorophenyl)anilino]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[1-[2-[[3-(4-chlorophenyl)anilino]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 151865649 |
| Molecular Formula | C24H29ClN4O4 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | methyl N-[1-[2-[[3-(4-chlorophenyl)anilino]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)NC(C(=O)N1CCCC1C(=O)NNc1cccc(-c2ccc(Cl)cc2)c1)C(C)C |
| InChI | InChI=1S/C24H29ClN4O4/c1-15(2)21(26-24(32)33-3)23(31)29-13-5-8-20(29)22(30)28-27-19-7-4-6-17(14-19)16-9-11-18(25)12-10-16/h4,6-7,9-12,14-15,20-21,27H,5,8,13H2,1-3H3,(H,26,32)(H,28,30) |
| InChIKey | SLPWJQHRXWGYMJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|