About 5-silylpent-1-enyl carbamate
5-silylpent-1-enyl carbamate (PubChem CID 151870333) has the molecular formula C6H13NO2Si
and a molecular weight of 159.26 g/mol. Its IUPAC name is 5-silylpent-1-enyl carbamate.
Molecular Properties
| Compound Name | 5-silylpent-1-enyl carbamate |
| PubChem CID | 151870333 |
| Molecular Formula | C6H13NO2Si |
| Molecular Weight | 159.26 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 5-silylpent-1-enyl carbamate |
| SMILES | NC(=O)OC=CCCC[SiH3] |
| InChI | InChI=1S/C6H13NO2Si/c7-6(8)9-4-2-1-3-5-10/h2,4H,1,3,5H2,10H3,(H2,7,8) |
| InChIKey | SMNZLWWDRUQUKN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.26 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-silylpent-1-enyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-silylpent-1-enyl carbamate?
The IUPAC name of 5-silylpent-1-enyl carbamate (CID 151870333) is 5-silylpent-1-enyl carbamate.
What is the SMILES notation for 5-silylpent-1-enyl carbamate?
The canonical SMILES for 5-silylpent-1-enyl carbamate is NC(=O)OC=CCCC[SiH3].
What is the InChIKey of 5-silylpent-1-enyl carbamate?
The InChIKey is SMNZLWWDRUQUKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2Si/c7-6(8)9-4-2-1-3-5-10/h2,4H,1,3,5H2,10H3,(H2,7,8).
What are the key properties of 5-silylpent-1-enyl carbamate?
5-silylpent-1-enyl carbamate has a molecular weight of 159.26 g/mol, XLogP of 0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-silylpent-1-enyl carbamate is sourced from PubChem (CID 151870333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).