About spiro[2,4-dihydrochromene-3,4'-piperidine]
spiro[2,4-dihydrochromene-3,4'-piperidine] (PubChem CID 15187048) has the molecular formula C13H17NO
and a molecular weight of 203.29 g/mol. Its IUPAC name is spiro[2,4-dihydrochromene-3,4'-piperidine].
Molecular Properties
| Compound Name | spiro[2,4-dihydrochromene-3,4'-piperidine] |
| PubChem CID | 15187048 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | spiro[2,4-dihydrochromene-3,4'-piperidine] |
| SMILES | c1ccc2c(c1)CC1(CCNCC1)CO2 |
| InChI | InChI=1S/C13H17NO/c1-2-4-12-11(3-1)9-13(10-15-12)5-7-14-8-6-13/h1-4,14H,5-10H2 |
| InChIKey | BYGRWGNUWGBFRX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[2,4-dihydrochromene-3,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2,4-dihydrochromene-3,4'-piperidine]?
The IUPAC name of spiro[2,4-dihydrochromene-3,4'-piperidine] (CID 15187048) is spiro[2,4-dihydrochromene-3,4'-piperidine].
What is the SMILES notation for spiro[2,4-dihydrochromene-3,4'-piperidine]?
The canonical SMILES for spiro[2,4-dihydrochromene-3,4'-piperidine] is c1ccc2c(c1)CC1(CCNCC1)CO2.
What is the InChIKey of spiro[2,4-dihydrochromene-3,4'-piperidine]?
The InChIKey is BYGRWGNUWGBFRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-2-4-12-11(3-1)9-13(10-15-12)5-7-14-8-6-13/h1-4,14H,5-10H2.
What are the key properties of spiro[2,4-dihydrochromene-3,4'-piperidine]?
spiro[2,4-dihydrochromene-3,4'-piperidine] has a molecular weight of 203.29 g/mol, XLogP of 1.99, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2,4-dihydrochromene-3,4'-piperidine] is sourced from PubChem (CID 15187048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).