About 2,2-dimethyl-1,3,2-benzodithiastannole
2,2-dimethyl-1,3,2-benzodithiastannole (PubChem CID 15187126) has the molecular formula C8H10S2Sn
and a molecular weight of 289.01 g/mol. Its IUPAC name is 2,2-dimethyl-1,3,2-benzodithiastannole.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,3,2-benzodithiastannole |
| PubChem CID | 15187126 |
| Molecular Formula | C8H10S2Sn |
| Molecular Weight | 289.01 g/mol |
| Exact Mass | 289.92 |
| IUPAC Name | 2,2-dimethyl-1,3,2-benzodithiastannole |
| SMILES | C[Sn]1(C)Sc2ccccc2S1 |
| InChI | InChI=1S/C6H6S2.2CH3.Sn/c7-5-3-1-2-4-6(5)8;;;/h1-4,7-8H;2*1H3;/q;;;+2/p-2 |
| InChIKey | QJLRENZOZKLWLD-UHFFFAOYSA-L |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.01 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-1,3,2-benzodithiastannole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,3,2-benzodithiastannole?
The IUPAC name of 2,2-dimethyl-1,3,2-benzodithiastannole (CID 15187126) is 2,2-dimethyl-1,3,2-benzodithiastannole.
What is the SMILES notation for 2,2-dimethyl-1,3,2-benzodithiastannole?
The canonical SMILES for 2,2-dimethyl-1,3,2-benzodithiastannole is C[Sn]1(C)Sc2ccccc2S1.
What is the InChIKey of 2,2-dimethyl-1,3,2-benzodithiastannole?
The InChIKey is QJLRENZOZKLWLD-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H6S2.2CH3.Sn/c7-5-3-1-2-4-6(5)8;;;/h1-4,7-8H;2*1H3;/q;;;+2/p-2.
What are the key properties of 2,2-dimethyl-1,3,2-benzodithiastannole?
2,2-dimethyl-1,3,2-benzodithiastannole has a molecular weight of 289.01 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,3,2-benzodithiastannole is sourced from PubChem (CID 15187126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).