About spiro[1H-indole-3,2'-oxirane]-2-one
spiro[1H-indole-3,2'-oxirane]-2-one (PubChem CID 15187162) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is spiro[1H-indole-3,2'-oxirane]-2-one.
Molecular Properties
| Compound Name | spiro[1H-indole-3,2'-oxirane]-2-one |
| PubChem CID | 15187162 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | spiro[1H-indole-3,2'-oxirane]-2-one |
| SMILES | O=C1Nc2ccccc2C12CO2 |
| InChI | InChI=1S/C9H7NO2/c11-8-9(5-12-9)6-3-1-2-4-7(6)10-8/h1-4H,5H2,(H,10,11) |
| InChIKey | CAKLDVBKFYKIQK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze spiro[1H-indole-3,2'-oxirane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1H-indole-3,2'-oxirane]-2-one?
The IUPAC name of spiro[1H-indole-3,2'-oxirane]-2-one (CID 15187162) is spiro[1H-indole-3,2'-oxirane]-2-one.
What is the SMILES notation for spiro[1H-indole-3,2'-oxirane]-2-one?
The canonical SMILES for spiro[1H-indole-3,2'-oxirane]-2-one is O=C1Nc2ccccc2C12CO2.
What is the InChIKey of spiro[1H-indole-3,2'-oxirane]-2-one?
The InChIKey is CAKLDVBKFYKIQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c11-8-9(5-12-9)6-3-1-2-4-7(6)10-8/h1-4H,5H2,(H,10,11).
What are the key properties of spiro[1H-indole-3,2'-oxirane]-2-one?
spiro[1H-indole-3,2'-oxirane]-2-one has a molecular weight of 161.16 g/mol, XLogP of 0.86, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1H-indole-3,2'-oxirane]-2-one is sourced from PubChem (CID 15187162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).