C37H54F2O5Si — CID 151873416
benzyl 7-[(1R,2R,3R)-2-(4,4-difluoro-3-trimethylsilyloxyoctyl)-5-oxo-3-phenylmethoxycyclopentyl]heptanoate (PubChem CID 151873416) has the molecular formula C37H54F2O5Si and a molecular weight of 644.92 g/mol. Its IUPAC name is benzyl 7-[(1R,2R,3R)-2-(4,4-difluoro-3-trimethylsilyloxyoctyl)-5-oxo-3-phenylmethoxycyclopentyl]heptanoate.
| Compound Name | benzyl 7-[(1R,2R,3R)-2-(4,4-difluoro-3-trimethylsilyloxyoctyl)-5-oxo-3-phenylmethoxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 151873416 |
| Molecular Formula | C37H54F2O5Si |
| Molecular Weight | 644.92 g/mol |
| Exact Mass | 644.37 |
| IUPAC Name | benzyl 7-[(1R,2R,3R)-2-(4,4-difluoro-3-trimethylsilyloxyoctyl)-5-oxo-3-phenylmethoxycyclopentyl]heptanoate |
| SMILES | CCCCC(F)(F)C(CC[C@H]1[C@H](OCc2ccccc2)CC(=O)[C@@H]1CCCCCCC(=O)OCc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C37H54F2O5Si/c1-5-6-25-37(38,39)35(44-45(2,3)4)24-23-32-31(33(40)26-34(32)42-27-29-17-11-9-12-18-29)21-15-7-8-16-22-36(41)43-28-30-19-13-10-14-20-30/h9-14,17-20,31-32,34-35H,5-8,15-16,21-28H2,1-4H3/t31-,32-,34-,35?/m1/s1 |
| InChIKey | SNEGXGOJJOJJIV-QGZXREKRSA-N |
| XLogP | 9.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.92 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|