C16H20F3NOSi — CID 15187747
2,2,2-trifluoro-1-[4-[(E)-2-trimethylsilylethenyl]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone (PubChem CID 15187747) has the molecular formula C16H20F3NOSi and a molecular weight of 327.42 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[(E)-2-trimethylsilylethenyl]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-[(E)-2-trimethylsilylethenyl]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 15187747 |
| Molecular Formula | C16H20F3NOSi |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[(E)-2-trimethylsilylethenyl]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
| SMILES | C[Si](C)(C)/C=C/C1CN(C(=O)C(F)(F)F)Cc2ccccc21 |
| InChI | InChI=1S/C16H20F3NOSi/c1-22(2,3)9-8-13-11-20(15(21)16(17,18)19)10-12-6-4-5-7-14(12)13/h4-9,13H,10-11H2,1-3H3/b9-8+ |
| InChIKey | YLKGKUJSANOYJP-CMDGGOBGSA-N |
| XLogP | 4.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|