About 2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde
2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde (PubChem CID 151882228) has the molecular formula C14H16FNO3
and a molecular weight of 265.28 g/mol. Its IUPAC name is 2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde.
Molecular Properties
| Compound Name | 2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde |
| PubChem CID | 151882228 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde |
| SMILES | COC1CCN(c2ccc(C=O)c(F)c2C=O)CC1 |
| InChI | InChI=1S/C14H16FNO3/c1-19-11-4-6-16(7-5-11)13-3-2-10(8-17)14(15)12(13)9-18/h2-3,8-9,11H,4-7H2,1H3 |
| InChIKey | SOYVATDSBJWQHY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde?
The IUPAC name of 2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde (CID 151882228) is 2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde.
What is the SMILES notation for 2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde?
The canonical SMILES for 2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde is COC1CCN(c2ccc(C=O)c(F)c2C=O)CC1.
What is the InChIKey of 2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde?
The InChIKey is SOYVATDSBJWQHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FNO3/c1-19-11-4-6-16(7-5-11)13-3-2-10(8-17)14(15)12(13)9-18/h2-3,8-9,11H,4-7H2,1H3.
What are the key properties of 2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde?
2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde has a molecular weight of 265.28 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-(4-methoxypiperidin-1-yl)benzene-1,3-dicarbaldehyde is sourced from PubChem (CID 151882228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).