About [diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate
[diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate (PubChem CID 151882777) has the molecular formula C12H16O8Si
and a molecular weight of 316.34 g/mol. Its IUPAC name is [diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate.
Molecular Properties
| Compound Name | [diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate |
| PubChem CID | 151882777 |
| Molecular Formula | C12H16O8Si |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | [diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate |
| SMILES | C=CC(OC(C)=O)C(=O)O[Si](C=C)(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C12H16O8Si/c1-6-11(17-8(3)13)12(16)20-21(7-2,18-9(4)14)19-10(5)15/h6-7,11H,1-2H2,3-5H3 |
| InChIKey | SPBKTOLSLFDPOT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate?
The IUPAC name of [diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate (CID 151882777) is [diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate.
What is the SMILES notation for [diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate?
The canonical SMILES for [diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate is C=CC(OC(C)=O)C(=O)O[Si](C=C)(OC(C)=O)OC(C)=O.
What is the InChIKey of [diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate?
The InChIKey is SPBKTOLSLFDPOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O8Si/c1-6-11(17-8(3)13)12(16)20-21(7-2,18-9(4)14)19-10(5)15/h6-7,11H,1-2H2,3-5H3.
What are the key properties of [diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate?
[diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate has a molecular weight of 316.34 g/mol, XLogP of 0.44, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [diacetyloxy(ethenyl)silyl] 2-acetyloxybut-3-enoate is sourced from PubChem (CID 151882777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).