C8H4Cl3N3 — CID 151882970
1-(2,3,4-trichlorophenyl)triazole (PubChem CID 151882970) has the molecular formula C8H4Cl3N3 and a molecular weight of 248.50 g/mol. Its IUPAC name is 1-(2,3,4-trichlorophenyl)triazole.
| Compound Name | 1-(2,3,4-trichlorophenyl)triazole |
|---|---|
| PubChem CID | 151882970 |
| Molecular Formula | C8H4Cl3N3 |
| Molecular Weight | 248.50 g/mol |
| Exact Mass | 246.95 |
| IUPAC Name | 1-(2,3,4-trichlorophenyl)triazole |
| SMILES | Clc1ccc(-n2ccnn2)c(Cl)c1Cl |
| InChI | InChI=1S/C8H4Cl3N3/c9-5-1-2-6(8(11)7(5)10)14-4-3-12-13-14/h1-4H |
| InChIKey | SPCKDTZYQJUULE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|